About N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide
N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide (PubChem CID 45093141) has the molecular formula C10H11NO4
and a molecular weight of 209.20 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide.
Molecular Properties
| Compound Name | N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide |
| PubChem CID | 45093141 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide |
| SMILES | CC(=O)NC[C@H](O)C1=CC(=O)C(=O)C=C1 |
| InChI | InChI=1S/C10H11NO4/c1-6(12)11-5-10(15)7-2-3-8(13)9(14)4-7/h2-4,10,15H,5H2,1H3,(H,11,12)/t10-/m0/s1 |
| InChIKey | QCWHABHLJAGBIG-JTQLQIEISA-N |
| XLogP | -0.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide?
The IUPAC name of N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide (CID 45093141) is N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide.
What is the SMILES notation for N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide?
The canonical SMILES for N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide is CC(=O)NC[C@H](O)C1=CC(=O)C(=O)C=C1.
What is the InChIKey of N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide?
The InChIKey is QCWHABHLJAGBIG-JTQLQIEISA-N. The full InChI is InChI=1S/C10H11NO4/c1-6(12)11-5-10(15)7-2-3-8(13)9(14)4-7/h2-4,10,15H,5H2,1H3,(H,11,12)/t10-/m0/s1.
What are the key properties of N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide?
N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide has a molecular weight of 209.20 g/mol, XLogP of -0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-2-(3,4-dioxocyclohexa-1,5-dien-1-yl)-2-hydroxyethyl]acetamide is sourced from PubChem (CID 45093141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).