C19H17N7O — CID 4509319
7-(3-imidazol-1-ylpropyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile (PubChem CID 4509319) has the molecular formula C19H17N7O and a molecular weight of 359.39 g/mol. Its IUPAC name is 7-(3-imidazol-1-ylpropyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile.
| Compound Name | 7-(3-imidazol-1-ylpropyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 4509319 |
| Molecular Formula | C19H17N7O |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 7-(3-imidazol-1-ylpropyl)-6-imino-11-methyl-2-oxo-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
| SMILES | [H]/N=c1\c(C#N)cc2c(=O)n3cccc(C)c3nc2n1CCCn1ccnc1 |
| InChI | InChI=1S/C19H17N7O/c1-13-4-2-7-26-17(13)23-18-15(19(26)27)10-14(11-20)16(21)25(18)8-3-6-24-9-5-22-12-24/h2,4-5,7,9-10,12,21H,3,6,8H2,1H3/b21-16+ |
| InChIKey | NPPJSJNEEATBCU-LTGZKZEYSA-N |
| XLogP | 1.60 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|