C5H12NO6P — CID 45093316
[(2R,3R,4S)-3,4-dihydroxypyrrolidin-2-yl]methyl dihydrogen phosphate (PubChem CID 45093316) has the molecular formula C5H12NO6P and a molecular weight of 213.13 g/mol. Its IUPAC name is [(2R,3R,4S)-3,4-dihydroxypyrrolidin-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4S)-3,4-dihydroxypyrrolidin-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 45093316 |
| Molecular Formula | C5H12NO6P |
| Molecular Weight | 213.13 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | [(2R,3R,4S)-3,4-dihydroxypyrrolidin-2-yl]methyl dihydrogen phosphate |
| SMILES | O=P(O)(O)OC[C@H]1NC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H12NO6P/c7-4-1-6-3(5(4)8)2-12-13(9,10)11/h3-8H,1-2H2,(H2,9,10,11)/t3-,4+,5-/m1/s1 |
| InChIKey | XMOGMJZMSFFUHF-MROZADKFSA-N |
| XLogP | -2.21 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.13 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|