C9H8N4O3 — CID 45093594
6-(3-hydroxyanilino)-1H-1,3,5-triazine-2,4-dione (PubChem CID 45093594) has the molecular formula C9H8N4O3 and a molecular weight of 220.19 g/mol. Its IUPAC name is 6-(3-hydroxyanilino)-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 6-(3-hydroxyanilino)-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 45093594 |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 6-(3-hydroxyanilino)-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc(Nc2cccc(O)c2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H8N4O3/c14-6-3-1-2-5(4-6)10-7-11-8(15)13-9(16)12-7/h1-4,14H,(H3,10,11,12,13,15,16) |
| InChIKey | UBGCOZUHPUFCCC-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |