About [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide
[4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide (PubChem CID 45093784) has the molecular formula C8H2F2N4O2
and a molecular weight of 224.13 g/mol. Its IUPAC name is [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide.
Molecular Properties
| Compound Name | [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide |
| PubChem CID | 45093784 |
| Molecular Formula | C8H2F2N4O2 |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide |
| SMILES | N#CNC1=C(F)C(=O)C(NC#N)=C(F)C1=O |
| InChI | InChI=1S/C8H2F2N4O2/c9-3-5(13-1-11)7(15)4(10)6(8(3)16)14-2-12/h13-14H |
| InChIKey | ALUINVXTFCTSCN-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide?
The IUPAC name of [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide (CID 45093784) is [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide.
What is the SMILES notation for [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide?
The canonical SMILES for [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide is N#CNC1=C(F)C(=O)C(NC#N)=C(F)C1=O.
What is the InChIKey of [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide?
The InChIKey is ALUINVXTFCTSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2F2N4O2/c9-3-5(13-1-11)7(15)4(10)6(8(3)16)14-2-12/h13-14H.
What are the key properties of [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide?
[4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide has a molecular weight of 224.13 g/mol, XLogP of -0.36, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(cyanoamino)-2,5-difluoro-3,6-dioxocyclohexa-1,4-dien-1-yl]cyanamide is sourced from PubChem (CID 45093784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).