About 4,4-diethoxy-1,2-dimethylpiperidine
4,4-diethoxy-1,2-dimethylpiperidine (PubChem CID 45093899) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 4,4-diethoxy-1,2-dimethylpiperidine.
Molecular Properties
| Compound Name | 4,4-diethoxy-1,2-dimethylpiperidine |
| PubChem CID | 45093899 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 4,4-diethoxy-1,2-dimethylpiperidine |
| SMILES | CCOC1(OCC)CCN(C)C(C)C1 |
| InChI | InChI=1S/C11H23NO2/c1-5-13-11(14-6-2)7-8-12(4)10(3)9-11/h10H,5-9H2,1-4H3 |
| InChIKey | MFBRNSXIMLHTEI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diethoxy-1,2-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethoxy-1,2-dimethylpiperidine?
The IUPAC name of 4,4-diethoxy-1,2-dimethylpiperidine (CID 45093899) is 4,4-diethoxy-1,2-dimethylpiperidine.
What is the SMILES notation for 4,4-diethoxy-1,2-dimethylpiperidine?
The canonical SMILES for 4,4-diethoxy-1,2-dimethylpiperidine is CCOC1(OCC)CCN(C)C(C)C1.
What is the InChIKey of 4,4-diethoxy-1,2-dimethylpiperidine?
The InChIKey is MFBRNSXIMLHTEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-13-11(14-6-2)7-8-12(4)10(3)9-11/h10H,5-9H2,1-4H3.
What are the key properties of 4,4-diethoxy-1,2-dimethylpiperidine?
4,4-diethoxy-1,2-dimethylpiperidine has a molecular weight of 201.31 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethoxy-1,2-dimethylpiperidine is sourced from PubChem (CID 45093899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).