About 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline
3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline (PubChem CID 45094345) has the molecular formula C13H14N2O
and a molecular weight of 214.27 g/mol. Its IUPAC name is 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline |
| PubChem CID | 45094345 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline |
| SMILES | CCOC1NCc2cc3ccccc3nc21 |
| InChI | InChI=1S/C13H14N2O/c1-2-16-13-12-10(8-14-13)7-9-5-3-4-6-11(9)15-12/h3-7,13-14H,2,8H2,1H3 |
| InChIKey | UQHUVMFNAKLVGR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline?
The IUPAC name of 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline (CID 45094345) is 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline.
What is the SMILES notation for 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline?
The canonical SMILES for 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline is CCOC1NCc2cc3ccccc3nc21.
What is the InChIKey of 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline?
The InChIKey is UQHUVMFNAKLVGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O/c1-2-16-13-12-10(8-14-13)7-9-5-3-4-6-11(9)15-12/h3-7,13-14H,2,8H2,1H3.
What are the key properties of 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline?
3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline has a molecular weight of 214.27 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-2,3-dihydro-1H-pyrrolo[3,4-b]quinoline is sourced from PubChem (CID 45094345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).