About 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine
2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine (PubChem CID 45094437) has the molecular formula C11H12N4O
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine.
Molecular Properties
| Compound Name | 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine |
| PubChem CID | 45094437 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine |
| SMILES | CCOc1[nH]n2c(nc3ccccc32)c1N |
| InChI | InChI=1S/C11H12N4O/c1-2-16-11-9(12)10-13-7-5-3-4-6-8(7)15(10)14-11/h3-6,14H,2,12H2,1H3 |
| InChIKey | RPHLDPMGJYTHNT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine?
The IUPAC name of 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine (CID 45094437) is 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine.
What is the SMILES notation for 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine?
The canonical SMILES for 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine is CCOc1[nH]n2c(nc3ccccc32)c1N.
What is the InChIKey of 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine?
The InChIKey is RPHLDPMGJYTHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N4O/c1-2-16-11-9(12)10-13-7-5-3-4-6-8(7)15(10)14-11/h3-6,14H,2,12H2,1H3.
What are the key properties of 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine?
2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine has a molecular weight of 216.24 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1H-pyrazolo[1,5-a]benzimidazol-3-amine is sourced from PubChem (CID 45094437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).