About ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate
ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate (PubChem CID 45094611) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate |
| PubChem CID | 45094611 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1COC(CC)(CC)N1 |
| InChI | InChI=1S/C10H19NO3/c1-4-10(5-2)11-8(7-14-10)9(12)13-6-3/h8,11H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | FPUHZSCXFABJRG-QMMMGPOBSA-N |
| XLogP | 1.05 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate?
The IUPAC name of ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate (CID 45094611) is ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate.
What is the SMILES notation for ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate?
The canonical SMILES for ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate is CCOC(=O)[C@@H]1COC(CC)(CC)N1.
What is the InChIKey of ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate?
The InChIKey is FPUHZSCXFABJRG-QMMMGPOBSA-N. The full InChI is InChI=1S/C10H19NO3/c1-4-10(5-2)11-8(7-14-10)9(12)13-6-3/h8,11H,4-7H2,1-3H3/t8-/m0/s1.
What are the key properties of ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate?
ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate has a molecular weight of 201.27 g/mol, XLogP of 1.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-2,2-diethyl-1,3-oxazolidine-4-carboxylate is sourced from PubChem (CID 45094611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).