About 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione
4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione (PubChem CID 45094802) has the molecular formula C6H10N2S3
and a molecular weight of 206.36 g/mol. Its IUPAC name is 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione.
Molecular Properties
| Compound Name | 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione |
| PubChem CID | 45094802 |
| Molecular Formula | C6H10N2S3 |
| Molecular Weight | 206.36 g/mol |
| Exact Mass | 206.00 |
| IUPAC Name | 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione |
| SMILES | CC/N=c1\ssc(=S)n1CC |
| InChI | InChI=1S/C6H10N2S3/c1-3-7-5-8(4-2)6(9)11-10-5/h3-4H2,1-2H3/b7-5- |
| InChIKey | ICMPHVOVYGKOAX-ALCCZGGFSA-N |
| XLogP | 2.28 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione?
The IUPAC name of 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione (CID 45094802) is 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione.
What is the SMILES notation for 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione?
The canonical SMILES for 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione is CC/N=c1\ssc(=S)n1CC.
What is the InChIKey of 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione?
The InChIKey is ICMPHVOVYGKOAX-ALCCZGGFSA-N. The full InChI is InChI=1S/C6H10N2S3/c1-3-7-5-8(4-2)6(9)11-10-5/h3-4H2,1-2H3/b7-5-.
What are the key properties of 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione?
4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione has a molecular weight of 206.36 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-ethylimino-1,2,4-dithiazolidine-3-thione is sourced from PubChem (CID 45094802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).