About 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol
2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol (PubChem CID 45094813) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol.
Molecular Properties
| Compound Name | 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol |
| PubChem CID | 45094813 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol |
| SMILES | CCC1(C)CCc2c(ccc(O)c2C)O1 |
| InChI | InChI=1S/C13H18O2/c1-4-13(3)8-7-10-9(2)11(14)5-6-12(10)15-13/h5-6,14H,4,7-8H2,1-3H3 |
| InChIKey | HWTWYRWTQQFQEH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol?
The IUPAC name of 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol (CID 45094813) is 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol.
What is the SMILES notation for 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol?
The canonical SMILES for 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol is CCC1(C)CCc2c(ccc(O)c2C)O1.
What is the InChIKey of 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol?
The InChIKey is HWTWYRWTQQFQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-4-13(3)8-7-10-9(2)11(14)5-6-12(10)15-13/h5-6,14H,4,7-8H2,1-3H3.
What are the key properties of 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol?
2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol has a molecular weight of 206.28 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2,5-dimethyl-3,4-dihydrochromen-6-ol is sourced from PubChem (CID 45094813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).