About N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine
N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine (PubChem CID 45094856) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine.
Molecular Properties
| Compound Name | N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine |
| PubChem CID | 45094856 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine |
| SMILES | CCc1cnc(CC)c(N[C@H](C)CC)n1 |
| InChI | InChI=1S/C12H21N3/c1-5-9(4)14-12-11(7-3)13-8-10(6-2)15-12/h8-9H,5-7H2,1-4H3,(H,14,15)/t9-/m1/s1 |
| InChIKey | BHTYUHDKIKTWNL-SECBINFHSA-N |
| XLogP | 2.81 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine?
The IUPAC name of N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine (CID 45094856) is N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine.
What is the SMILES notation for N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine?
The canonical SMILES for N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine is CCc1cnc(CC)c(N[C@H](C)CC)n1.
What is the InChIKey of N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine?
The InChIKey is BHTYUHDKIKTWNL-SECBINFHSA-N. The full InChI is InChI=1S/C12H21N3/c1-5-9(4)14-12-11(7-3)13-8-10(6-2)15-12/h8-9H,5-7H2,1-4H3,(H,14,15)/t9-/m1/s1.
What are the key properties of N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine?
N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine has a molecular weight of 207.32 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2R)-butan-2-yl]-3,6-diethylpyrazin-2-amine is sourced from PubChem (CID 45094856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).