C11H15NO3 — CID 45094911
methyl 2-ethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 45094911) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is methyl 2-ethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
| Compound Name | methyl 2-ethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
|---|---|
| PubChem CID | 45094911 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | methyl 2-ethyl-3-oxo-8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | CCC1C(=O)CC2C=CC1N2C(=O)OC |
| InChI | InChI=1S/C11H15NO3/c1-3-8-9-5-4-7(6-10(8)13)12(9)11(14)15-2/h4-5,7-9H,3,6H2,1-2H3 |
| InChIKey | KZHOPQRWZNBEEI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|