About 2,4-diethyl-N,6-dihydroxybenzamide
2,4-diethyl-N,6-dihydroxybenzamide (PubChem CID 45094929) has the molecular formula C11H15NO3
and a molecular weight of 209.24 g/mol. Its IUPAC name is 2,4-diethyl-N,6-dihydroxybenzamide.
Molecular Properties
| Compound Name | 2,4-diethyl-N,6-dihydroxybenzamide |
| PubChem CID | 45094929 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 2,4-diethyl-N,6-dihydroxybenzamide |
| SMILES | CCc1cc(O)c(C(=O)NO)c(CC)c1 |
| InChI | InChI=1S/C11H15NO3/c1-3-7-5-8(4-2)10(9(13)6-7)11(14)12-15/h5-6,13,15H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | GAEYIRYMIPJCOR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diethyl-N,6-dihydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diethyl-N,6-dihydroxybenzamide?
The IUPAC name of 2,4-diethyl-N,6-dihydroxybenzamide (CID 45094929) is 2,4-diethyl-N,6-dihydroxybenzamide.
What is the SMILES notation for 2,4-diethyl-N,6-dihydroxybenzamide?
The canonical SMILES for 2,4-diethyl-N,6-dihydroxybenzamide is CCc1cc(O)c(C(=O)NO)c(CC)c1.
What is the InChIKey of 2,4-diethyl-N,6-dihydroxybenzamide?
The InChIKey is GAEYIRYMIPJCOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3/c1-3-7-5-8(4-2)10(9(13)6-7)11(14)12-15/h5-6,13,15H,3-4H2,1-2H3,(H,12,14).
What are the key properties of 2,4-diethyl-N,6-dihydroxybenzamide?
2,4-diethyl-N,6-dihydroxybenzamide has a molecular weight of 209.24 g/mol, XLogP of 1.64, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diethyl-N,6-dihydroxybenzamide is sourced from PubChem (CID 45094929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).