About (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one
(3R,4S)-1-benzyl-3,4-diethylazetidin-2-one (PubChem CID 45095274) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one.
Molecular Properties
| Compound Name | (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one |
| PubChem CID | 45095274 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one |
| SMILES | CC[C@H]1C(=O)N(Cc2ccccc2)[C@H]1CC |
| InChI | InChI=1S/C14H19NO/c1-3-12-13(4-2)15(14(12)16)10-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | GBQQEIODPBBRGC-OLZOCXBDSA-N |
| XLogP | 2.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one?
The IUPAC name of (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one (CID 45095274) is (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one.
What is the SMILES notation for (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one?
The canonical SMILES for (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one is CC[C@H]1C(=O)N(Cc2ccccc2)[C@H]1CC.
What is the InChIKey of (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one?
The InChIKey is GBQQEIODPBBRGC-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H19NO/c1-3-12-13(4-2)15(14(12)16)10-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one?
(3R,4S)-1-benzyl-3,4-diethylazetidin-2-one has a molecular weight of 217.31 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-1-benzyl-3,4-diethylazetidin-2-one is sourced from PubChem (CID 45095274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).