About 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid
6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid (PubChem CID 45095497) has the molecular formula C9H9N3O4
and a molecular weight of 223.19 g/mol. Its IUPAC name is 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid.
Molecular Properties
| Compound Name | 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid |
| PubChem CID | 45095497 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid |
| SMILES | CCn1nc(C(=O)O)c2c(C)onc2c1=O |
| InChI | InChI=1S/C9H9N3O4/c1-3-12-8(13)6-5(4(2)16-11-6)7(10-12)9(14)15/h3H2,1-2H3,(H,14,15) |
| InChIKey | JTYIIOWIXFYNCZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The IUPAC name of 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid (CID 45095497) is 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid.
What is the SMILES notation for 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The canonical SMILES for 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid is CCn1nc(C(=O)O)c2c(C)onc2c1=O.
What is the InChIKey of 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
The InChIKey is JTYIIOWIXFYNCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O4/c1-3-12-8(13)6-5(4(2)16-11-6)7(10-12)9(14)15/h3H2,1-2H3,(H,14,15).
What are the key properties of 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid?
6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid has a molecular weight of 223.19 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methyl-7-oxo-[1,2]oxazolo[3,4-d]pyridazine-4-carboxylic acid is sourced from PubChem (CID 45095497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).