About (2R,3R)-2-ethyl-2,3-diphenyloxirane
(2R,3R)-2-ethyl-2,3-diphenyloxirane (PubChem CID 45095524) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-2,3-diphenyloxirane.
Molecular Properties
| Compound Name | (2R,3R)-2-ethyl-2,3-diphenyloxirane |
| PubChem CID | 45095524 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (2R,3R)-2-ethyl-2,3-diphenyloxirane |
| SMILES | CC[C@]1(c2ccccc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H16O/c1-2-16(14-11-7-4-8-12-14)15(17-16)13-9-5-3-6-10-13/h3-12,15H,2H2,1H3/t15-,16-/m1/s1 |
| InChIKey | WTVDAZOYXCCQFU-HZPDHXFCSA-N |
| XLogP | 4.06 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-2-ethyl-2,3-diphenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-ethyl-2,3-diphenyloxirane?
The IUPAC name of (2R,3R)-2-ethyl-2,3-diphenyloxirane (CID 45095524) is (2R,3R)-2-ethyl-2,3-diphenyloxirane.
What is the SMILES notation for (2R,3R)-2-ethyl-2,3-diphenyloxirane?
The canonical SMILES for (2R,3R)-2-ethyl-2,3-diphenyloxirane is CC[C@]1(c2ccccc2)O[C@@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-2-ethyl-2,3-diphenyloxirane?
The InChIKey is WTVDAZOYXCCQFU-HZPDHXFCSA-N. The full InChI is InChI=1S/C16H16O/c1-2-16(14-11-7-4-8-12-14)15(17-16)13-9-5-3-6-10-13/h3-12,15H,2H2,1H3/t15-,16-/m1/s1.
What are the key properties of (2R,3R)-2-ethyl-2,3-diphenyloxirane?
(2R,3R)-2-ethyl-2,3-diphenyloxirane has a molecular weight of 224.30 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-ethyl-2,3-diphenyloxirane is sourced from PubChem (CID 45095524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).