About O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine
O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine (PubChem CID 45096041) has the molecular formula C6H11N3O2
and a molecular weight of 157.17 g/mol. Its IUPAC name is O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine |
| PubChem CID | 45096041 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine |
| SMILES | CC(C)c1nnc(CON)o1 |
| InChI | InChI=1S/C6H11N3O2/c1-4(2)6-9-8-5(11-6)3-10-7/h4H,3,7H2,1-2H3 |
| InChIKey | FCRLLQZOHKDZOE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine?
The IUPAC name of O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine (CID 45096041) is O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine.
What is the SMILES notation for O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine?
The canonical SMILES for O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine is CC(C)c1nnc(CON)o1.
What is the InChIKey of O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine?
The InChIKey is FCRLLQZOHKDZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O2/c1-4(2)6-9-8-5(11-6)3-10-7/h4H,3,7H2,1-2H3.
What are the key properties of O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine?
O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine has a molecular weight of 157.17 g/mol, XLogP of 0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(5-propan-2-yl-1,3,4-oxadiazol-2-yl)methyl]hydroxylamine is sourced from PubChem (CID 45096041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).