About 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine
4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine (PubChem CID 45096361) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine.
Molecular Properties
| Compound Name | 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine |
| PubChem CID | 45096361 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine |
| SMILES | CC1=CC(C)(C)N=C(C(C)C)O1 |
| InChI | InChI=1S/C10H17NO/c1-7(2)9-11-10(4,5)6-8(3)12-9/h6-7H,1-5H3 |
| InChIKey | ZIRXRLWGAPXESI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine?
The IUPAC name of 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine (CID 45096361) is 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine.
What is the SMILES notation for 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine?
The canonical SMILES for 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine is CC1=CC(C)(C)N=C(C(C)C)O1.
What is the InChIKey of 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine?
The InChIKey is ZIRXRLWGAPXESI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-7(2)9-11-10(4,5)6-8(3)12-9/h6-7H,1-5H3.
What are the key properties of 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine?
4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine has a molecular weight of 167.25 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,6-trimethyl-2-propan-2-yl-1,3-oxazine is sourced from PubChem (CID 45096361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).