About 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran
2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran (PubChem CID 45096540) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran |
| PubChem CID | 45096540 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran |
| SMILES | COC1C=C(C(C)C)C(OC)O1 |
| InChI | InChI=1S/C9H16O3/c1-6(2)7-5-8(10-3)12-9(7)11-4/h5-6,8-9H,1-4H3 |
| InChIKey | BXWYQBPTPGBNNX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran?
The IUPAC name of 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran (CID 45096540) is 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran.
What is the SMILES notation for 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran?
The canonical SMILES for 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran is COC1C=C(C(C)C)C(OC)O1.
What is the InChIKey of 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran?
The InChIKey is BXWYQBPTPGBNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-6(2)7-5-8(10-3)12-9(7)11-4/h5-6,8-9H,1-4H3.
What are the key properties of 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran?
2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran has a molecular weight of 172.22 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethoxy-3-propan-2-yl-2,5-dihydrofuran is sourced from PubChem (CID 45096540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).