About 1-methyl-3-propan-2-yl-2,3-dihydroindole
1-methyl-3-propan-2-yl-2,3-dihydroindole (PubChem CID 45096641) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-methyl-3-propan-2-yl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-methyl-3-propan-2-yl-2,3-dihydroindole |
| PubChem CID | 45096641 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-methyl-3-propan-2-yl-2,3-dihydroindole |
| SMILES | CC(C)C1CN(C)c2ccccc21 |
| InChI | InChI=1S/C12H17N/c1-9(2)11-8-13(3)12-7-5-4-6-10(11)12/h4-7,9,11H,8H2,1-3H3 |
| InChIKey | BURNNDJOLHCXBG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-3-propan-2-yl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propan-2-yl-2,3-dihydroindole?
The IUPAC name of 1-methyl-3-propan-2-yl-2,3-dihydroindole (CID 45096641) is 1-methyl-3-propan-2-yl-2,3-dihydroindole.
What is the SMILES notation for 1-methyl-3-propan-2-yl-2,3-dihydroindole?
The canonical SMILES for 1-methyl-3-propan-2-yl-2,3-dihydroindole is CC(C)C1CN(C)c2ccccc21.
What is the InChIKey of 1-methyl-3-propan-2-yl-2,3-dihydroindole?
The InChIKey is BURNNDJOLHCXBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-9(2)11-8-13(3)12-7-5-4-6-10(11)12/h4-7,9,11H,8H2,1-3H3.
What are the key properties of 1-methyl-3-propan-2-yl-2,3-dihydroindole?
1-methyl-3-propan-2-yl-2,3-dihydroindole has a molecular weight of 175.28 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propan-2-yl-2,3-dihydroindole is sourced from PubChem (CID 45096641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).