About 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one
4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (PubChem CID 45096794) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| PubChem CID | 45096794 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one |
| SMILES | CN1C(=O)CS(=O)C12CCNCC2 |
| InChI | InChI=1S/C8H14N2O2S/c1-10-7(11)6-13(12)8(10)2-4-9-5-3-8/h9H,2-6H2,1H3 |
| InChIKey | WAKHPQZSPNXYGN-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The IUPAC name of 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one (CID 45096794) is 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one.
What is the SMILES notation for 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The canonical SMILES for 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is CN1C(=O)CS(=O)C12CCNCC2.
What is the InChIKey of 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
The InChIKey is WAKHPQZSPNXYGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-10-7(11)6-13(12)8(10)2-4-9-5-3-8/h9H,2-6H2,1H3.
What are the key properties of 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one?
4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one has a molecular weight of 202.28 g/mol, XLogP of -0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-oxo-1λ4-thia-4,8-diazaspiro[4.5]decan-3-one is sourced from PubChem (CID 45096794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).