About 4-(2-methylphenyl)-1,4-diazepan-5-one
4-(2-methylphenyl)-1,4-diazepan-5-one (PubChem CID 45096923) has the molecular formula C12H16N2O
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-(2-methylphenyl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)-1,4-diazepan-5-one |
| PubChem CID | 45096923 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 4-(2-methylphenyl)-1,4-diazepan-5-one |
| SMILES | Cc1ccccc1N1CCNCCC1=O |
| InChI | InChI=1S/C12H16N2O/c1-10-4-2-3-5-11(10)14-9-8-13-7-6-12(14)15/h2-5,13H,6-9H2,1H3 |
| InChIKey | DOXKYFUNTSXLAO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-methylphenyl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)-1,4-diazepan-5-one?
The IUPAC name of 4-(2-methylphenyl)-1,4-diazepan-5-one (CID 45096923) is 4-(2-methylphenyl)-1,4-diazepan-5-one.
What is the SMILES notation for 4-(2-methylphenyl)-1,4-diazepan-5-one?
The canonical SMILES for 4-(2-methylphenyl)-1,4-diazepan-5-one is Cc1ccccc1N1CCNCCC1=O.
What is the InChIKey of 4-(2-methylphenyl)-1,4-diazepan-5-one?
The InChIKey is DOXKYFUNTSXLAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O/c1-10-4-2-3-5-11(10)14-9-8-13-7-6-12(14)15/h2-5,13H,6-9H2,1H3.
What are the key properties of 4-(2-methylphenyl)-1,4-diazepan-5-one?
4-(2-methylphenyl)-1,4-diazepan-5-one has a molecular weight of 204.27 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)-1,4-diazepan-5-one is sourced from PubChem (CID 45096923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).