C7H10N4S2 — CID 45097400
8-methyl-2-methylsulfanyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-4-thione (PubChem CID 45097400) has the molecular formula C7H10N4S2 and a molecular weight of 214.32 g/mol. Its IUPAC name is 8-methyl-2-methylsulfanyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-4-thione.
| Compound Name | 8-methyl-2-methylsulfanyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 45097400 |
| Molecular Formula | C7H10N4S2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 8-methyl-2-methylsulfanyl-6,7-dihydroimidazo[1,2-a][1,3,5]triazine-4-thione |
| SMILES | CSc1nc2n(c(=S)n1)CCN2C |
| InChI | InChI=1S/C7H10N4S2/c1-10-3-4-11-6(10)8-5(13-2)9-7(11)12/h3-4H2,1-2H3 |
| InChIKey | XCBISVFWFASKMB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|