About tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate
tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate (PubChem CID 45097990) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate.
Molecular Properties
| Compound Name | tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate |
| PubChem CID | 45097990 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)C1=NC(C)(C)CO1 |
| InChI | InChI=1S/C12H21NO3/c1-8(10(14)16-11(2,3)4)9-13-12(5,6)7-15-9/h8H,7H2,1-6H3 |
| InChIKey | PXEAKGUJPFQDJJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate?
The IUPAC name of tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate (CID 45097990) is tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate.
What is the SMILES notation for tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate?
The canonical SMILES for tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate is CC(C(=O)OC(C)(C)C)C1=NC(C)(C)CO1.
What is the InChIKey of tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate?
The InChIKey is PXEAKGUJPFQDJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO3/c1-8(10(14)16-11(2,3)4)9-13-12(5,6)7-15-9/h8H,7H2,1-6H3.
What are the key properties of tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate?
tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate has a molecular weight of 227.30 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(4,4-dimethyl-5H-1,3-oxazol-2-yl)propanoate is sourced from PubChem (CID 45097990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).