C10H17N — CID 45098299
2-[(1R,3R)-2,2,3-trimethylcyclopentyl]acetonitrile (PubChem CID 45098299) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-[(1R,3R)-2,2,3-trimethylcyclopentyl]acetonitrile.
| Compound Name | 2-[(1R,3R)-2,2,3-trimethylcyclopentyl]acetonitrile |
|---|---|
| PubChem CID | 45098299 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-[(1R,3R)-2,2,3-trimethylcyclopentyl]acetonitrile |
| SMILES | C[C@@H]1CC[C@H](CC#N)C1(C)C |
| InChI | InChI=1S/C10H17N/c1-8-4-5-9(6-7-11)10(8,2)3/h8-9H,4-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | AXRYRAJOZGKFNZ-RKDXNWHRSA-N |
| XLogP | 2.97 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |