C9H14O2 — CID 45098405
6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 45098405) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane.
| Compound Name | 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane |
|---|---|
| PubChem CID | 45098405 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | CCOC1CC2CC1C1OC21 |
| InChI | InChI=1S/C9H14O2/c1-2-10-7-4-5-3-6(7)9-8(5)11-9/h5-9H,2-4H2,1H3 |
| InChIKey | DNKHUTSSAGDAIT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|