About 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane
6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane (PubChem CID 45098405) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane.
Molecular Properties
| Compound Name | 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane |
| PubChem CID | 45098405 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane |
| SMILES | CCOC1CC2CC1C1OC21 |
| InChI | InChI=1S/C9H14O2/c1-2-10-7-4-5-3-6(7)9-8(5)11-9/h5-9H,2-4H2,1H3 |
| InChIKey | DNKHUTSSAGDAIT-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The IUPAC name of 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane (CID 45098405) is 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane.
What is the SMILES notation for 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The canonical SMILES for 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane is CCOC1CC2CC1C1OC21.
What is the InChIKey of 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane?
The InChIKey is DNKHUTSSAGDAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-2-10-7-4-5-3-6(7)9-8(5)11-9/h5-9H,2-4H2,1H3.
What are the key properties of 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane?
6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane has a molecular weight of 154.21 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-3-oxatricyclo[3.2.1.02,4]octane is sourced from PubChem (CID 45098405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).