About 7-methyl-6-azatricyclo[6.2.1.02,6]undecane
7-methyl-6-azatricyclo[6.2.1.02,6]undecane (PubChem CID 45098495) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 7-methyl-6-azatricyclo[6.2.1.02,6]undecane.
Molecular Properties
| Compound Name | 7-methyl-6-azatricyclo[6.2.1.02,6]undecane |
| PubChem CID | 45098495 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 7-methyl-6-azatricyclo[6.2.1.02,6]undecane |
| SMILES | CC1C2CCC(C2)C2CCCN12 |
| InChI | InChI=1S/C11H19N/c1-8-9-4-5-10(7-9)11-3-2-6-12(8)11/h8-11H,2-7H2,1H3 |
| InChIKey | WVDIOEXNXHPVHH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-6-azatricyclo[6.2.1.02,6]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6-azatricyclo[6.2.1.02,6]undecane?
The IUPAC name of 7-methyl-6-azatricyclo[6.2.1.02,6]undecane (CID 45098495) is 7-methyl-6-azatricyclo[6.2.1.02,6]undecane.
What is the SMILES notation for 7-methyl-6-azatricyclo[6.2.1.02,6]undecane?
The canonical SMILES for 7-methyl-6-azatricyclo[6.2.1.02,6]undecane is CC1C2CCC(C2)C2CCCN12.
What is the InChIKey of 7-methyl-6-azatricyclo[6.2.1.02,6]undecane?
The InChIKey is WVDIOEXNXHPVHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-8-9-4-5-10(7-9)11-3-2-6-12(8)11/h8-11H,2-7H2,1H3.
What are the key properties of 7-methyl-6-azatricyclo[6.2.1.02,6]undecane?
7-methyl-6-azatricyclo[6.2.1.02,6]undecane has a molecular weight of 165.28 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6-azatricyclo[6.2.1.02,6]undecane is sourced from PubChem (CID 45098495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).