About 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one
9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one (PubChem CID 45098553) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one.
Molecular Properties
| Compound Name | 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one |
| PubChem CID | 45098553 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one |
| SMILES | O=C1NC2C3CC(C4CC=CC43)C12 |
| InChI | InChI=1S/C11H13NO/c13-11-9-7-4-8(10(9)12-11)6-3-1-2-5(6)7/h1,3,5-10H,2,4H2,(H,12,13) |
| InChIKey | JZWLSEBCEXNDSB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one?
The IUPAC name of 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one (CID 45098553) is 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one.
What is the SMILES notation for 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one?
The canonical SMILES for 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one is O=C1NC2C3CC(C4CC=CC43)C12.
What is the InChIKey of 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one?
The InChIKey is JZWLSEBCEXNDSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c13-11-9-7-4-8(10(9)12-11)6-3-1-2-5(6)7/h1,3,5-10H,2,4H2,(H,12,13).
What are the key properties of 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one?
9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one has a molecular weight of 175.23 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-azatetracyclo[5.4.1.02,6.08,11]dodec-4-en-10-one is sourced from PubChem (CID 45098553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).