About 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one
2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one (PubChem CID 45098825) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one.
Molecular Properties
| Compound Name | 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one |
| PubChem CID | 45098825 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one |
| SMILES | C=CCC1CC(C)C(=O)C1(C)OCC |
| InChI | InChI=1S/C12H20O2/c1-5-7-10-8-9(3)11(13)12(10,4)14-6-2/h5,9-10H,1,6-8H2,2-4H3 |
| InChIKey | ODKNDZZJQQZAKR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one?
The IUPAC name of 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one (CID 45098825) is 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one.
What is the SMILES notation for 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one?
The canonical SMILES for 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one is C=CCC1CC(C)C(=O)C1(C)OCC.
What is the InChIKey of 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one?
The InChIKey is ODKNDZZJQQZAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-5-7-10-8-9(3)11(13)12(10,4)14-6-2/h5,9-10H,1,6-8H2,2-4H3.
What are the key properties of 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one?
2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one has a molecular weight of 196.29 g/mol, XLogP of 2.58, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2,5-dimethyl-3-prop-2-enylcyclopentan-1-one is sourced from PubChem (CID 45098825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).