C11H16O3 — CID 45098826
(1R,4E,5S)-4-(hydroxymethylidene)-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one (PubChem CID 45098826) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (1R,4E,5S)-4-(hydroxymethylidene)-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,4E,5S)-4-(hydroxymethylidene)-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 45098826 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (1R,4E,5S)-4-(hydroxymethylidene)-1,8,8-trimethyl-2-oxabicyclo[3.2.1]octan-3-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)OC(=O)/C2=C/O |
| InChI | InChI=1S/C11H16O3/c1-10(2)8-4-5-11(10,3)14-9(13)7(8)6-12/h6,8,12H,4-5H2,1-3H3/b7-6+/t8-,11-/m1/s1 |
| InChIKey | OYJFEASTOPPEKV-CXBYFFTPSA-N |
| XLogP | 2.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|