About (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol
(1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol (PubChem CID 45098940) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol.
Molecular Properties
| Compound Name | (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol |
| PubChem CID | 45098940 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol |
| SMILES | CN[C@@H]1c2cccc3cccc(c23)[C@H]1O |
| InChI | InChI=1S/C13H13NO/c1-14-12-9-6-2-4-8-5-3-7-10(11(8)9)13(12)15/h2-7,12-15H,1H3/t12-,13-/m1/s1 |
| InChIKey | WVOMXVUXVVWHQB-CHWSQXEVSA-N |
| XLogP | 2.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol?
The IUPAC name of (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol (CID 45098940) is (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol.
What is the SMILES notation for (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol?
The canonical SMILES for (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol is CN[C@@H]1c2cccc3cccc(c23)[C@H]1O.
What is the InChIKey of (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol?
The InChIKey is WVOMXVUXVVWHQB-CHWSQXEVSA-N. The full InChI is InChI=1S/C13H13NO/c1-14-12-9-6-2-4-8-5-3-7-10(11(8)9)13(12)15/h2-7,12-15H,1H3/t12-,13-/m1/s1.
What are the key properties of (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol?
(1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol has a molecular weight of 199.25 g/mol, XLogP of 2.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R)-2-(methylamino)-1,2-dihydroacenaphthylen-1-ol is sourced from PubChem (CID 45098940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).