About 4-ethyl-3-propyl-4H-1,2-oxazol-5-one
4-ethyl-3-propyl-4H-1,2-oxazol-5-one (PubChem CID 45098999) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-ethyl-3-propyl-4H-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 4-ethyl-3-propyl-4H-1,2-oxazol-5-one |
| PubChem CID | 45098999 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-ethyl-3-propyl-4H-1,2-oxazol-5-one |
| SMILES | CCCC1=NOC(=O)C1CC |
| InChI | InChI=1S/C8H13NO2/c1-3-5-7-6(4-2)8(10)11-9-7/h6H,3-5H2,1-2H3 |
| InChIKey | IBQCUXACMDWHFK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze 4-ethyl-3-propyl-4H-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-3-propyl-4H-1,2-oxazol-5-one?
The IUPAC name of 4-ethyl-3-propyl-4H-1,2-oxazol-5-one (CID 45098999) is 4-ethyl-3-propyl-4H-1,2-oxazol-5-one.
What is the SMILES notation for 4-ethyl-3-propyl-4H-1,2-oxazol-5-one?
The canonical SMILES for 4-ethyl-3-propyl-4H-1,2-oxazol-5-one is CCCC1=NOC(=O)C1CC.
What is the InChIKey of 4-ethyl-3-propyl-4H-1,2-oxazol-5-one?
The InChIKey is IBQCUXACMDWHFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO2/c1-3-5-7-6(4-2)8(10)11-9-7/h6H,3-5H2,1-2H3.
What are the key properties of 4-ethyl-3-propyl-4H-1,2-oxazol-5-one?
4-ethyl-3-propyl-4H-1,2-oxazol-5-one has a molecular weight of 155.20 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-3-propyl-4H-1,2-oxazol-5-one is sourced from PubChem (CID 45098999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).