About 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide
3-methoxy-N-methyl-1,2-oxazole-5-carboxamide (PubChem CID 45099122) has the molecular formula C6H8N2O3
and a molecular weight of 156.14 g/mol. Its IUPAC name is 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 45099122 |
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CNC(=O)c1cc(OC)no1 |
| InChI | InChI=1S/C6H8N2O3/c1-7-6(9)4-3-5(10-2)8-11-4/h3H,1-2H3,(H,7,9) |
| InChIKey | UJDFTIZIYFXNMI-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide (CID 45099122) is 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide is CNC(=O)c1cc(OC)no1.
What is the InChIKey of 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is UJDFTIZIYFXNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O3/c1-7-6(9)4-3-5(10-2)8-11-4/h3H,1-2H3,(H,7,9).
What are the key properties of 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
3-methoxy-N-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 156.14 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 45099122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).