About [1,2]oxazolo[4,3-g]indolizine
[1,2]oxazolo[4,3-g]indolizine (PubChem CID 45099171) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is [1,2]oxazolo[4,3-g]indolizine.
Molecular Properties
| Compound Name | [1,2]oxazolo[4,3-g]indolizine |
| PubChem CID | 45099171 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | [1,2]oxazolo[4,3-g]indolizine |
| SMILES | c1cc2c3nocc3ccn2c1 |
| InChI | InChI=1S/C9H6N2O/c1-2-8-9-7(6-12-10-9)3-5-11(8)4-1/h1-6H |
| InChIKey | XBFWHARSGWAPJN-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,2]oxazolo[4,3-g]indolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2]oxazolo[4,3-g]indolizine?
The IUPAC name of [1,2]oxazolo[4,3-g]indolizine (CID 45099171) is [1,2]oxazolo[4,3-g]indolizine.
What is the SMILES notation for [1,2]oxazolo[4,3-g]indolizine?
The canonical SMILES for [1,2]oxazolo[4,3-g]indolizine is c1cc2c3nocc3ccn2c1.
What is the InChIKey of [1,2]oxazolo[4,3-g]indolizine?
The InChIKey is XBFWHARSGWAPJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-2-8-9-7(6-12-10-9)3-5-11(8)4-1/h1-6H.
What are the key properties of [1,2]oxazolo[4,3-g]indolizine?
[1,2]oxazolo[4,3-g]indolizine has a molecular weight of 158.16 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2]oxazolo[4,3-g]indolizine is sourced from PubChem (CID 45099171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).