About N-chloro-5-methyl-1,2-oxazole-3-carboxamide
N-chloro-5-methyl-1,2-oxazole-3-carboxamide (PubChem CID 45099208) has the molecular formula C5H5ClN2O2
and a molecular weight of 160.56 g/mol. Its IUPAC name is N-chloro-5-methyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-chloro-5-methyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 45099208 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | N-chloro-5-methyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCl)no1 |
| InChI | InChI=1S/C5H5ClN2O2/c1-3-2-4(8-10-3)5(9)7-6/h2H,1H3,(H,7,9) |
| InChIKey | UUCCHTZJYRBGBP-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-5-methyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-5-methyl-1,2-oxazole-3-carboxamide?
The IUPAC name of N-chloro-5-methyl-1,2-oxazole-3-carboxamide (CID 45099208) is N-chloro-5-methyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-chloro-5-methyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-chloro-5-methyl-1,2-oxazole-3-carboxamide is Cc1cc(C(=O)NCl)no1.
What is the InChIKey of N-chloro-5-methyl-1,2-oxazole-3-carboxamide?
The InChIKey is UUCCHTZJYRBGBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5ClN2O2/c1-3-2-4(8-10-3)5(9)7-6/h2H,1H3,(H,7,9).
What are the key properties of N-chloro-5-methyl-1,2-oxazole-3-carboxamide?
N-chloro-5-methyl-1,2-oxazole-3-carboxamide has a molecular weight of 160.56 g/mol, XLogP of 0.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-5-methyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 45099208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).