About N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide
N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 45099279) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide |
| PubChem CID | 45099279 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1onc(C)c1C#N |
| InChI | InChI=1S/C7H7N3O2/c1-4-6(3-8)7(12-10-4)9-5(2)11/h1-2H3,(H,9,11) |
| InChIKey | XNLFWQIUOGAYCP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide?
The IUPAC name of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide (CID 45099279) is N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide.
What is the SMILES notation for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide?
The canonical SMILES for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide is CC(=O)Nc1onc(C)c1C#N.
What is the InChIKey of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide?
The InChIKey is XNLFWQIUOGAYCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c1-4-6(3-8)7(12-10-4)9-5(2)11/h1-2H3,(H,9,11).
What are the key properties of N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide?
N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide has a molecular weight of 165.15 g/mol, XLogP of 0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyano-3-methyl-1,2-oxazol-5-yl)acetamide is sourced from PubChem (CID 45099279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).