About 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole
4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole (PubChem CID 45099307) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole |
| PubChem CID | 45099307 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2cnoc2)=N1 |
| InChI | InChI=1S/C8H10N2O2/c1-8(2)5-11-7(10-8)6-3-9-12-4-6/h3-4H,5H2,1-2H3 |
| InChIKey | SWUAHLDSKXDQGJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole?
The IUPAC name of 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole (CID 45099307) is 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole.
What is the SMILES notation for 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole?
The canonical SMILES for 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole is CC1(C)COC(c2cnoc2)=N1.
What is the InChIKey of 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole?
The InChIKey is SWUAHLDSKXDQGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-8(2)5-11-7(10-8)6-3-9-12-4-6/h3-4H,5H2,1-2H3.
What are the key properties of 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole?
4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole has a molecular weight of 166.18 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(1,2-oxazol-4-yl)-5H-1,3-oxazole is sourced from PubChem (CID 45099307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).