C6H12N2S2 — CID 45099650
(2R,3R)-1,4-diazabicyclo[2.2.2]octane-2,3-dithiol (PubChem CID 45099650) has the molecular formula C6H12N2S2 and a molecular weight of 176.31 g/mol. Its IUPAC name is (2R,3R)-1,4-diazabicyclo[2.2.2]octane-2,3-dithiol.
| Compound Name | (2R,3R)-1,4-diazabicyclo[2.2.2]octane-2,3-dithiol |
|---|---|
| PubChem CID | 45099650 |
| Molecular Formula | C6H12N2S2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.04 |
| IUPAC Name | (2R,3R)-1,4-diazabicyclo[2.2.2]octane-2,3-dithiol |
| SMILES | S[C@@H]1[C@@H](S)N2CCN1CC2 |
| InChI | InChI=1S/C6H12N2S2/c9-5-6(10)8-2-1-7(5)3-4-8/h5-6,9-10H,1-4H2/t5-,6-/m1/s1 |
| InChIKey | PHTDWDSCSMAJQD-PHDIDXHHSA-N |
| XLogP | 0.13 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|