About 6-fluoro-2,3-dimethylquinoxaline
6-fluoro-2,3-dimethylquinoxaline (PubChem CID 45099672) has the molecular formula C10H9FN2
and a molecular weight of 176.19 g/mol. Its IUPAC name is 6-fluoro-2,3-dimethylquinoxaline.
Molecular Properties
| Compound Name | 6-fluoro-2,3-dimethylquinoxaline |
| PubChem CID | 45099672 |
| Molecular Formula | C10H9FN2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 6-fluoro-2,3-dimethylquinoxaline |
| SMILES | Cc1nc2ccc(F)cc2nc1C |
| InChI | InChI=1S/C10H9FN2/c1-6-7(2)13-10-5-8(11)3-4-9(10)12-6/h3-5H,1-2H3 |
| InChIKey | OCEWKKNSJQLOQZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2,3-dimethylquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,3-dimethylquinoxaline?
The IUPAC name of 6-fluoro-2,3-dimethylquinoxaline (CID 45099672) is 6-fluoro-2,3-dimethylquinoxaline.
What is the SMILES notation for 6-fluoro-2,3-dimethylquinoxaline?
The canonical SMILES for 6-fluoro-2,3-dimethylquinoxaline is Cc1nc2ccc(F)cc2nc1C.
What is the InChIKey of 6-fluoro-2,3-dimethylquinoxaline?
The InChIKey is OCEWKKNSJQLOQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2/c1-6-7(2)13-10-5-8(11)3-4-9(10)12-6/h3-5H,1-2H3.
What are the key properties of 6-fluoro-2,3-dimethylquinoxaline?
6-fluoro-2,3-dimethylquinoxaline has a molecular weight of 176.19 g/mol, XLogP of 2.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,3-dimethylquinoxaline is sourced from PubChem (CID 45099672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).