About 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine
1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine (PubChem CID 45099705) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine |
| PubChem CID | 45099705 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine |
| SMILES | CN1CCN(C2C=CCC=C2)CC1 |
| InChI | InChI=1S/C11H18N2/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11/h3-6,11H,2,7-10H2,1H3 |
| InChIKey | NWADIRHFBRVAEE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine?
The IUPAC name of 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine (CID 45099705) is 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine.
What is the SMILES notation for 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine?
The canonical SMILES for 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine is CN1CCN(C2C=CCC=C2)CC1.
What is the InChIKey of 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine?
The InChIKey is NWADIRHFBRVAEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-12-7-9-13(10-8-12)11-5-3-2-4-6-11/h3-6,11H,2,7-10H2,1H3.
What are the key properties of 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine?
1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine has a molecular weight of 178.28 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,5-dien-1-yl-4-methylpiperazine is sourced from PubChem (CID 45099705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).