About 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one
3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one (PubChem CID 45099835) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
Molecular Properties
| Compound Name | 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| PubChem CID | 45099835 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| SMILES | CCN1CC2CC(=O)CC(C1)N2C |
| InChI | InChI=1S/C10H18N2O/c1-3-12-6-8-4-10(13)5-9(7-12)11(8)2/h8-9H,3-7H2,1-2H3 |
| InChIKey | APYKODXEZAZXEW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The IUPAC name of 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one (CID 45099835) is 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
What is the SMILES notation for 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The canonical SMILES for 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one is CCN1CC2CC(=O)CC(C1)N2C.
What is the InChIKey of 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The InChIKey is APYKODXEZAZXEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-12-6-8-4-10(13)5-9(7-12)11(8)2/h8-9H,3-7H2,1-2H3.
What are the key properties of 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one has a molecular weight of 182.27 g/mol, XLogP of 0.35, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one is sourced from PubChem (CID 45099835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).