C18H19F3N2O4 — CID 45100106
2-(3,5-dimethoxyanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide (PubChem CID 45100106) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 2-(3,5-dimethoxyanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 2-(3,5-dimethoxyanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 45100106 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-(3,5-dimethoxyanilino)-N-[4-(trifluoromethoxy)phenyl]propanamide |
| SMILES | COc1cc(NC(C)C(=O)Nc2ccc(OC(F)(F)F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C18H19F3N2O4/c1-11(22-13-8-15(25-2)10-16(9-13)26-3)17(24)23-12-4-6-14(7-5-12)27-18(19,20)21/h4-11,22H,1-3H3,(H,23,24) |
| InChIKey | IDPFQSUSYYIPON-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |