About [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate
[(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate (PubChem CID 45100292) has the molecular formula C18H22N2O2
and a molecular weight of 298.39 g/mol. Its IUPAC name is [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate.
Molecular Properties
| Compound Name | [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate |
| PubChem CID | 45100292 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate |
| SMILES | C=C1/C(=N/OC(=O)Nc2ccc(C)cc2)CC2CC1C2(C)C |
| InChI | InChI=1S/C18H22N2O2/c1-11-5-7-14(8-6-11)19-17(21)22-20-16-10-13-9-15(12(16)2)18(13,3)4/h5-8,13,15H,2,9-10H2,1,3-4H3,(H,19,21)/b20-16+ |
| InChIKey | DYPOGWKRZPIPFG-CAPFRKAQSA-N |
| XLogP | 4.52 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate?
The IUPAC name of [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate (CID 45100292) is [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate.
What is the SMILES notation for [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate?
The canonical SMILES for [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate is C=C1/C(=N/OC(=O)Nc2ccc(C)cc2)CC2CC1C2(C)C.
What is the InChIKey of [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate?
The InChIKey is DYPOGWKRZPIPFG-CAPFRKAQSA-N. The full InChI is InChI=1S/C18H22N2O2/c1-11-5-7-14(8-6-11)19-17(21)22-20-16-10-13-9-15(12(16)2)18(13,3)4/h5-8,13,15H,2,9-10H2,1,3-4H3,(H,19,21)/b20-16+.
What are the key properties of [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate?
[(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate has a molecular weight of 298.39 g/mol, XLogP of 4.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-(4-methylphenyl)carbamate is sourced from PubChem (CID 45100292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).