C15H15N3O2S3 — CID 4510065
N-(6-ethyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-3-yl)-4,5-dimethylthiophene-3-carboxamide (PubChem CID 4510065) has the molecular formula C15H15N3O2S3 and a molecular weight of 365.51 g/mol. Its IUPAC name is N-(6-ethyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-3-yl)-4,5-dimethylthiophene-3-carboxamide.
| Compound Name | N-(6-ethyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-3-yl)-4,5-dimethylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 4510065 |
| Molecular Formula | C15H15N3O2S3 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | N-(6-ethyl-4-oxo-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-3-yl)-4,5-dimethylthiophene-3-carboxamide |
| SMILES | CCc1cc2c(=O)n(NC(=O)c3csc(C)c3C)c(=S)[nH]c2s1 |
| InChI | InChI=1S/C15H15N3O2S3/c1-4-9-5-10-13(23-9)16-15(21)18(14(10)20)17-12(19)11-6-22-8(3)7(11)2/h5-6H,4H2,1-3H3,(H,16,21)(H,17,19) |
| InChIKey | WHTHBNXOHNXWCQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|