C13H17ClN2O2 — CID 45100729
(4S)-4-[(2S)-2-(4-chlorophenoxy)butyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 45100729) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is (4S)-4-[(2S)-2-(4-chlorophenoxy)butyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[(2S)-2-(4-chlorophenoxy)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 45100729 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (4S)-4-[(2S)-2-(4-chlorophenoxy)butyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CC[C@@H](C[C@H]1COC(N)=N1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-2-11(7-10-8-17-13(15)16-10)18-12-5-3-9(14)4-6-12/h3-6,10-11H,2,7-8H2,1H3,(H2,15,16)/t10-,11-/m0/s1 |
| InChIKey | SOCJLEPKLPTDKI-QWRGUYRKSA-N |
| XLogP | 2.60 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |