C12H15FN5O6P — CID 45100790
9-[(4aR,6R,7R,7aR)-7-fluoro-2-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine (PubChem CID 45100790) has the molecular formula C12H15FN5O6P and a molecular weight of 375.25 g/mol. Its IUPAC name is 9-[(4aR,6R,7R,7aR)-7-fluoro-2-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine.
| Compound Name | 9-[(4aR,6R,7R,7aR)-7-fluoro-2-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
|---|---|
| PubChem CID | 45100790 |
| Molecular Formula | C12H15FN5O6P |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | 9-[(4aR,6R,7R,7aR)-7-fluoro-2-hydroxy-7-methyl-2-oxo-4,4a,6,7a-tetrahydrofuro[3,2-d][1,3,2]dioxaphosphinin-6-yl]-6-methoxypurin-2-amine |
| SMILES | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@@]1(C)F |
| InChI | InChI=1S/C12H15FN5O6P/c1-12(13)7-5(3-22-25(19,20)24-7)23-10(12)18-4-15-6-8(18)16-11(14)17-9(6)21-2/h4-5,7,10H,3H2,1-2H3,(H,19,20)(H2,14,16,17)/t5-,7-,10-,12-/m1/s1 |
| InChIKey | SYUSODIXCBJNRD-GSWPYSDESA-N |
| XLogP | 0.56 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|