C14H18F2N2O — CID 45101104
(4S)-4-[3-(3,5-difluorophenyl)pentyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 45101104) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is (4S)-4-[3-(3,5-difluorophenyl)pentyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | (4S)-4-[3-(3,5-difluorophenyl)pentyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 45101104 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (4S)-4-[3-(3,5-difluorophenyl)pentyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | CCC(CC[C@H]1COC(N)=N1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H18F2N2O/c1-2-9(3-4-13-8-19-14(17)18-13)10-5-11(15)7-12(16)6-10/h5-7,9,13H,2-4,8H2,1H3,(H2,17,18)/t9?,13-/m0/s1 |
| InChIKey | XBEMACKBPFOIJR-NCWAPJAISA-N |
| XLogP | 2.95 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |