C18H26O8S — CID 45101443
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5S,6R)-5-hydroxy-6-phenylmethoxyoxan-3-yl]sulfanyloxane-3,4,5-triol (PubChem CID 45101443) has the molecular formula C18H26O8S and a molecular weight of 402.47 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5S,6R)-5-hydroxy-6-phenylmethoxyoxan-3-yl]sulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5S,6R)-5-hydroxy-6-phenylmethoxyoxan-3-yl]sulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 45101443 |
| Molecular Formula | C18H26O8S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[(3S,5S,6R)-5-hydroxy-6-phenylmethoxyoxan-3-yl]sulfanyloxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](S[C@@H]2CO[C@@H](OCc3ccccc3)[C@@H](O)C2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H26O8S/c19-7-13-14(21)15(22)16(23)18(26-13)27-11-6-12(20)17(25-9-11)24-8-10-4-2-1-3-5-10/h1-5,11-23H,6-9H2/t11-,12-,13+,14-,15-,16+,17+,18-/m0/s1 |
| InChIKey | XCAXFAYZOFLGOH-MWVUGINQSA-N |
| XLogP | -0.79 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |