C24H35N3O2S2 — CID 45101480
5-[[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]methyl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 45101480) has the molecular formula C24H35N3O2S2 and a molecular weight of 461.70 g/mol. Its IUPAC name is 5-[[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]methyl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 5-[[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]methyl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 45101480 |
| Molecular Formula | C24H35N3O2S2 |
| Molecular Weight | 461.70 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 5-[[1-[5-(dithiolan-3-yl)pentyl]triazol-4-yl]methyl]-2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(Cc3cn(CCCCCC4CCSS4)nn3)c1O)CCC(C)(C)O2 |
| InChI | InChI=1S/C24H35N3O2S2/c1-16-17(2)23-20(9-11-24(3,4)29-23)21(22(16)28)14-18-15-27(26-25-18)12-7-5-6-8-19-10-13-30-31-19/h15,19,28H,5-14H2,1-4H3 |
| InChIKey | GEKBZYGRDRNQRK-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.70 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|